C18H17ClO2 — CID 21322338
1-[3-(4-chlorophenoxy)phenyl]hex-1-yn-3-ol (PubChem CID 21322338) has the molecular formula C18H17ClO2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 1-[3-(4-chlorophenoxy)phenyl]hex-1-yn-3-ol.
| Compound Name | 1-[3-(4-chlorophenoxy)phenyl]hex-1-yn-3-ol |
|---|---|
| PubChem CID | 21322338 |
| Molecular Formula | C18H17ClO2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-[3-(4-chlorophenoxy)phenyl]hex-1-yn-3-ol |
| SMILES | CCCC(O)C#Cc1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H17ClO2/c1-2-4-16(20)10-7-14-5-3-6-18(13-14)21-17-11-8-15(19)9-12-17/h3,5-6,8-9,11-13,16,20H,2,4H2,1H3 |
| InChIKey | JEFOIQGKFNLDAV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|