C18H22ClOP — CID 91091253
6-[3-(4-chlorophenoxy)phenyl]hexan-3-ylphosphane (PubChem CID 91091253) has the molecular formula C18H22ClOP and a molecular weight of 320.80 g/mol. Its IUPAC name is 6-[3-(4-chlorophenoxy)phenyl]hexan-3-ylphosphane.
| Compound Name | 6-[3-(4-chlorophenoxy)phenyl]hexan-3-ylphosphane |
|---|---|
| PubChem CID | 91091253 |
| Molecular Formula | C18H22ClOP |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 6-[3-(4-chlorophenoxy)phenyl]hexan-3-ylphosphane |
| SMILES | CCC(P)CCCc1cccc(Oc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H22ClOP/c1-2-18(21)8-4-6-14-5-3-7-17(13-14)20-16-11-9-15(19)10-12-16/h3,5,7,9-13,18H,2,4,6,8,21H2,1H3 |
| InChIKey | LNKWPJPXKFVZJN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|