C26H29ClO — CID 21269895
1-chloro-4-[3-methyl-6-[3-(4-methylphenoxy)phenyl]hexan-3-yl]benzene (PubChem CID 21269895) has the molecular formula C26H29ClO and a molecular weight of 392.97 g/mol. Its IUPAC name is 1-chloro-4-[3-methyl-6-[3-(4-methylphenoxy)phenyl]hexan-3-yl]benzene.
| Compound Name | 1-chloro-4-[3-methyl-6-[3-(4-methylphenoxy)phenyl]hexan-3-yl]benzene |
|---|---|
| PubChem CID | 21269895 |
| Molecular Formula | C26H29ClO |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 1-chloro-4-[3-methyl-6-[3-(4-methylphenoxy)phenyl]hexan-3-yl]benzene |
| SMILES | CCC(C)(CCCc1cccc(Oc2ccc(C)cc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H29ClO/c1-4-26(3,22-12-14-23(27)15-13-22)18-6-8-21-7-5-9-25(19-21)28-24-16-10-20(2)11-17-24/h5,7,9-17,19H,4,6,8,18H2,1-3H3 |
| InChIKey | WRWBDMMHVGMZLP-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |