C26H27ClF2O2 — CID 21269645
1-chloro-3-[3-[4-[4-(difluoromethoxy)phenyl]-4-methylhexyl]phenoxy]benzene (PubChem CID 21269645) has the molecular formula C26H27ClF2O2 and a molecular weight of 444.95 g/mol. Its IUPAC name is 1-chloro-3-[3-[4-[4-(difluoromethoxy)phenyl]-4-methylhexyl]phenoxy]benzene.
| Compound Name | 1-chloro-3-[3-[4-[4-(difluoromethoxy)phenyl]-4-methylhexyl]phenoxy]benzene |
|---|---|
| PubChem CID | 21269645 |
| Molecular Formula | C26H27ClF2O2 |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-chloro-3-[3-[4-[4-(difluoromethoxy)phenyl]-4-methylhexyl]phenoxy]benzene |
| SMILES | CCC(C)(CCCc1cccc(Oc2cccc(Cl)c2)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C26H27ClF2O2/c1-3-26(2,20-12-14-22(15-13-20)31-25(28)29)16-6-8-19-7-4-10-23(17-19)30-24-11-5-9-21(27)18-24/h4-5,7,9-15,17-18,25H,3,6,8,16H2,1-2H3 |
| InChIKey | GAIYFNYYKWUZTK-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |