C25H27ClO2 — CID 21269875
1-chloro-4-[5-[3-(4-methoxyphenoxy)phenyl]-2-methylpentan-2-yl]benzene (PubChem CID 21269875) has the molecular formula C25H27ClO2 and a molecular weight of 394.94 g/mol. Its IUPAC name is 1-chloro-4-[5-[3-(4-methoxyphenoxy)phenyl]-2-methylpentan-2-yl]benzene.
| Compound Name | 1-chloro-4-[5-[3-(4-methoxyphenoxy)phenyl]-2-methylpentan-2-yl]benzene |
|---|---|
| PubChem CID | 21269875 |
| Molecular Formula | C25H27ClO2 |
| Molecular Weight | 394.94 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-chloro-4-[5-[3-(4-methoxyphenoxy)phenyl]-2-methylpentan-2-yl]benzene |
| SMILES | COc1ccc(Oc2cccc(CCCC(C)(C)c3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C25H27ClO2/c1-25(2,20-9-11-21(26)12-10-20)17-5-7-19-6-4-8-24(18-19)28-23-15-13-22(27-3)14-16-23/h4,6,8-16,18H,5,7,17H2,1-3H3 |
| InChIKey | JOEXRNGJXLRVSY-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.94 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |