C28H30O3 — CID 88645587
1-ethoxy-4-[6-[3-(4-methoxyphenoxy)phenyl]-3-methylhex-1-yn-3-yl]benzene (PubChem CID 88645587) has the molecular formula C28H30O3 and a molecular weight of 414.55 g/mol. Its IUPAC name is 1-ethoxy-4-[6-[3-(4-methoxyphenoxy)phenyl]-3-methylhex-1-yn-3-yl]benzene.
| Compound Name | 1-ethoxy-4-[6-[3-(4-methoxyphenoxy)phenyl]-3-methylhex-1-yn-3-yl]benzene |
|---|---|
| PubChem CID | 88645587 |
| Molecular Formula | C28H30O3 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-ethoxy-4-[6-[3-(4-methoxyphenoxy)phenyl]-3-methylhex-1-yn-3-yl]benzene |
| SMILES | C#CC(C)(CCCc1cccc(Oc2ccc(OC)cc2)c1)c1ccc(OCC)cc1 |
| InChI | InChI=1S/C28H30O3/c1-5-28(3,23-12-14-25(15-13-23)30-6-2)20-8-10-22-9-7-11-27(21-22)31-26-18-16-24(29-4)17-19-26/h1,7,9,11-19,21H,6,8,10,20H2,2-4H3 |
| InChIKey | TZNXXWOEZSESSA-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|