C25H28O3 — CID 68720967
3-(4-ethoxyphenyl)-3-methyl-1-(3-phenoxyphenyl)butan-2-ol (PubChem CID 68720967) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-3-methyl-1-(3-phenoxyphenyl)butan-2-ol.
| Compound Name | 3-(4-ethoxyphenyl)-3-methyl-1-(3-phenoxyphenyl)butan-2-ol |
|---|---|
| PubChem CID | 68720967 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-(4-ethoxyphenyl)-3-methyl-1-(3-phenoxyphenyl)butan-2-ol |
| SMILES | CCOc1ccc(C(C)(C)C(O)Cc2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H28O3/c1-4-27-21-15-13-20(14-16-21)25(2,3)24(26)18-19-9-8-12-23(17-19)28-22-10-6-5-7-11-22/h5-17,24,26H,4,18H2,1-3H3 |
| InChIKey | LDVJNOGTFRWZOR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |