C25H28O3 — CID 67941962
1-[(1-ethoxy-2-methyl-2-phenylpropoxy)methyl]-3-phenoxybenzene (PubChem CID 67941962) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[(1-ethoxy-2-methyl-2-phenylpropoxy)methyl]-3-phenoxybenzene.
| Compound Name | 1-[(1-ethoxy-2-methyl-2-phenylpropoxy)methyl]-3-phenoxybenzene |
|---|---|
| PubChem CID | 67941962 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 1-[(1-ethoxy-2-methyl-2-phenylpropoxy)methyl]-3-phenoxybenzene |
| SMILES | CCOC(OCc1cccc(Oc2ccccc2)c1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C25H28O3/c1-4-26-24(25(2,3)21-13-7-5-8-14-21)27-19-20-12-11-17-23(18-20)28-22-15-9-6-10-16-22/h5-18,24H,4,19H2,1-3H3 |
| InChIKey | VDHZXEKQBPWHTE-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|