C25H27ClO3 — CID 3067183
2-chloro-1-ethoxy-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene (PubChem CID 3067183) has the molecular formula C25H27ClO3 and a molecular weight of 410.94 g/mol. Its IUPAC name is 2-chloro-1-ethoxy-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene.
| Compound Name | 2-chloro-1-ethoxy-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
|---|---|
| PubChem CID | 3067183 |
| Molecular Formula | C25H27ClO3 |
| Molecular Weight | 410.94 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-chloro-1-ethoxy-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
| SMILES | CCOc1ccc(C(C)(C)COCc2cccc(Oc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C25H27ClO3/c1-4-28-24-14-13-20(16-23(24)26)25(2,3)18-27-17-19-9-8-12-22(15-19)29-21-10-6-5-7-11-21/h5-16H,4,17-18H2,1-3H3 |
| InChIKey | PLGYQISBTYZBSZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.94 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |