C27H31ClO3 — CID 139636486
1-butan-2-yloxy-2-chloro-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene (PubChem CID 139636486) has the molecular formula C27H31ClO3 and a molecular weight of 439.00 g/mol. Its IUPAC name is 1-butan-2-yloxy-2-chloro-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene.
| Compound Name | 1-butan-2-yloxy-2-chloro-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
|---|---|
| PubChem CID | 139636486 |
| Molecular Formula | C27H31ClO3 |
| Molecular Weight | 439.00 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1-butan-2-yloxy-2-chloro-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
| SMILES | CCC(C)Oc1ccc(C(C)(C)COCc2cccc(Oc3ccccc3)c2)cc1Cl |
| InChI | InChI=1S/C27H31ClO3/c1-5-20(2)30-26-15-14-22(17-25(26)28)27(3,4)19-29-18-21-10-9-13-24(16-21)31-23-11-7-6-8-12-23/h6-17,20H,5,18-19H2,1-4H3 |
| InChIKey | KVQYONCKGIPELM-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.00 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |