C24H25BrO3 — CID 139636498
2-bromo-1-methoxy-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene (PubChem CID 139636498) has the molecular formula C24H25BrO3 and a molecular weight of 441.37 g/mol. Its IUPAC name is 2-bromo-1-methoxy-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene.
| Compound Name | 2-bromo-1-methoxy-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
|---|---|
| PubChem CID | 139636498 |
| Molecular Formula | C24H25BrO3 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-bromo-1-methoxy-4-[2-methyl-1-[(3-phenoxyphenyl)methoxy]propan-2-yl]benzene |
| SMILES | COc1ccc(C(C)(C)COCc2cccc(Oc3ccccc3)c2)cc1Br |
| InChI | InChI=1S/C24H25BrO3/c1-24(2,19-12-13-23(26-3)22(25)15-19)17-27-16-18-8-7-11-21(14-18)28-20-9-5-4-6-10-20/h4-15H,16-17H2,1-3H3 |
| InChIKey | QRZBYSRXWZNSDU-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |