C28H34O2 — CID 21269835
1-butan-2-yloxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene (PubChem CID 21269835) has the molecular formula C28H34O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 1-butan-2-yloxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene.
| Compound Name | 1-butan-2-yloxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene |
|---|---|
| PubChem CID | 21269835 |
| Molecular Formula | C28H34O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-butan-2-yloxy-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene |
| SMILES | CCC(C)Oc1ccc(C(C)(C)CCCc2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H34O2/c1-5-22(2)29-26-18-16-24(17-19-26)28(3,4)20-10-12-23-11-9-15-27(21-23)30-25-13-7-6-8-14-25/h6-9,11,13-19,21-22H,5,10,12,20H2,1-4H3 |
| InChIKey | CNWNFRZNAUURAU-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |