C26H26Cl2O2 — CID 21269733
1-(2,2-dichloroethenoxy)-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene (PubChem CID 21269733) has the molecular formula C26H26Cl2O2 and a molecular weight of 441.40 g/mol. Its IUPAC name is 1-(2,2-dichloroethenoxy)-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene.
| Compound Name | 1-(2,2-dichloroethenoxy)-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene |
|---|---|
| PubChem CID | 21269733 |
| Molecular Formula | C26H26Cl2O2 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 1-(2,2-dichloroethenoxy)-4-[2-methyl-5-(3-phenoxyphenyl)pentan-2-yl]benzene |
| SMILES | CC(C)(CCCc1cccc(Oc2ccccc2)c1)c1ccc(OC=C(Cl)Cl)cc1 |
| InChI | InChI=1S/C26H26Cl2O2/c1-26(2,21-13-15-22(16-14-21)29-19-25(27)28)17-7-9-20-8-6-12-24(18-20)30-23-10-4-3-5-11-23/h3-6,8,10-16,18-19H,7,9,17H2,1-2H3 |
| InChIKey | DQPHPGBAOFRLIP-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|