C28H32O2 — CID 70413302
1-[3-methyl-6-(3-phenoxyphenyl)hex-1-en-3-yl]-4-propan-2-yloxybenzene (PubChem CID 70413302) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is 1-[3-methyl-6-(3-phenoxyphenyl)hex-1-en-3-yl]-4-propan-2-yloxybenzene.
| Compound Name | 1-[3-methyl-6-(3-phenoxyphenyl)hex-1-en-3-yl]-4-propan-2-yloxybenzene |
|---|---|
| PubChem CID | 70413302 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1-[3-methyl-6-(3-phenoxyphenyl)hex-1-en-3-yl]-4-propan-2-yloxybenzene |
| SMILES | C=CC(C)(CCCc1cccc(Oc2ccccc2)c1)c1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C28H32O2/c1-5-28(4,24-16-18-26(19-17-24)29-22(2)3)20-10-12-23-11-9-15-27(21-23)30-25-13-7-6-8-14-25/h5-9,11,13-19,21-22H,1,10,12,20H2,2-4H3 |
| InChIKey | UWWPJPDRHQIZSQ-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|