C28H28O4 — CID 70476258
6-(4-ethoxyphenyl)-6-methyl-3-(3-phenoxyphenyl)hept-4-ynoic acid (PubChem CID 70476258) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-6-methyl-3-(3-phenoxyphenyl)hept-4-ynoic acid.
| Compound Name | 6-(4-ethoxyphenyl)-6-methyl-3-(3-phenoxyphenyl)hept-4-ynoic acid |
|---|---|
| PubChem CID | 70476258 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 6-(4-ethoxyphenyl)-6-methyl-3-(3-phenoxyphenyl)hept-4-ynoic acid |
| SMILES | CCOc1ccc(C(C)(C)C#CC(CC(=O)O)c2cccc(Oc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H28O4/c1-4-31-24-15-13-23(14-16-24)28(2,3)18-17-22(20-27(29)30)21-9-8-12-26(19-21)32-25-10-6-5-7-11-25/h5-16,19,22H,4,20H2,1-3H3,(H,29,30) |
| InChIKey | QNQCJEDGVWPHSD-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|