C28H28OS — CID 88646505
1-[3-methyl-6-(3-phenylsulfanylphenyl)hex-1-yn-3-yl]-4-prop-2-enoxybenzene (PubChem CID 88646505) has the molecular formula C28H28OS and a molecular weight of 412.60 g/mol. Its IUPAC name is 1-[3-methyl-6-(3-phenylsulfanylphenyl)hex-1-yn-3-yl]-4-prop-2-enoxybenzene.
| Compound Name | 1-[3-methyl-6-(3-phenylsulfanylphenyl)hex-1-yn-3-yl]-4-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 88646505 |
| Molecular Formula | C28H28OS |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 1-[3-methyl-6-(3-phenylsulfanylphenyl)hex-1-yn-3-yl]-4-prop-2-enoxybenzene |
| SMILES | C#CC(C)(CCCc1cccc(Sc2ccccc2)c1)c1ccc(OCC=C)cc1 |
| InChI | InChI=1S/C28H28OS/c1-4-21-29-25-18-16-24(17-19-25)28(3,5-2)20-10-12-23-11-9-15-27(22-23)30-26-13-7-6-8-14-26/h2,4,6-9,11,13-19,22H,1,10,12,20-21H2,3H3 |
| InChIKey | VZPFEVOPSLGCMK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|