C27H26FNO2 — CID 88645033
4-fluoro-2-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-6-phenoxypyridine (PubChem CID 88645033) has the molecular formula C27H26FNO2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 4-fluoro-2-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-6-phenoxypyridine.
| Compound Name | 4-fluoro-2-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-6-phenoxypyridine |
|---|---|
| PubChem CID | 88645033 |
| Molecular Formula | C27H26FNO2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 4-fluoro-2-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]-6-phenoxypyridine |
| SMILES | C#CC(C)(CCCc1cc(F)cc(Oc2ccccc2)n1)c1ccc(OCC=C)cc1 |
| InChI | InChI=1S/C27H26FNO2/c1-4-18-30-24-15-13-21(14-16-24)27(3,5-2)17-9-10-23-19-22(28)20-26(29-23)31-25-11-7-6-8-12-25/h2,4,6-8,11-16,19-20H,1,9-10,17-18H2,3H3 |
| InChIKey | SVOZZASUUGOFLQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|