C29H28ClFO — CID 88646017
2-[(4-chlorophenyl)methyl]-1-fluoro-4-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]benzene (PubChem CID 88646017) has the molecular formula C29H28ClFO and a molecular weight of 446.99 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-fluoro-4-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]benzene.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-fluoro-4-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]benzene |
|---|---|
| PubChem CID | 88646017 |
| Molecular Formula | C29H28ClFO |
| Molecular Weight | 446.99 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-fluoro-4-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-ynyl]benzene |
| SMILES | C#CC(C)(CCCc1ccc(F)c(Cc2ccc(Cl)cc2)c1)c1ccc(OCC=C)cc1 |
| InChI | InChI=1S/C29H28ClFO/c1-4-19-32-27-15-11-25(12-16-27)29(3,5-2)18-6-7-22-10-17-28(31)24(20-22)21-23-8-13-26(30)14-9-23/h2,4,8-17,20H,1,6-7,18-19,21H2,3H3 |
| InChIKey | PQUXBBYYOKUVSQ-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.99 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|