C25H22ClFO — CID 88645740
1-chloro-4-[6-[3-(4-fluorophenoxy)phenyl]-3-methylhex-1-yn-3-yl]benzene (PubChem CID 88645740) has the molecular formula C25H22ClFO and a molecular weight of 392.90 g/mol. Its IUPAC name is 1-chloro-4-[6-[3-(4-fluorophenoxy)phenyl]-3-methylhex-1-yn-3-yl]benzene.
| Compound Name | 1-chloro-4-[6-[3-(4-fluorophenoxy)phenyl]-3-methylhex-1-yn-3-yl]benzene |
|---|---|
| PubChem CID | 88645740 |
| Molecular Formula | C25H22ClFO |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-chloro-4-[6-[3-(4-fluorophenoxy)phenyl]-3-methylhex-1-yn-3-yl]benzene |
| SMILES | C#CC(C)(CCCc1cccc(Oc2ccc(F)cc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H22ClFO/c1-3-25(2,20-9-11-21(26)12-10-20)17-5-7-19-6-4-8-24(18-19)28-23-15-13-22(27)14-16-23/h1,4,6,8-16,18H,5,7,17H2,2H3 |
| InChIKey | DEUODVAGXNTWJH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|