C25H21BrClFO — CID 88645439
2-(4-bromophenoxy)-4-[4-(4-chlorophenyl)-4-methylhex-5-ynyl]-1-fluorobenzene (PubChem CID 88645439) has the molecular formula C25H21BrClFO and a molecular weight of 471.80 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-4-[4-(4-chlorophenyl)-4-methylhex-5-ynyl]-1-fluorobenzene.
| Compound Name | 2-(4-bromophenoxy)-4-[4-(4-chlorophenyl)-4-methylhex-5-ynyl]-1-fluorobenzene |
|---|---|
| PubChem CID | 88645439 |
| Molecular Formula | C25H21BrClFO |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 2-(4-bromophenoxy)-4-[4-(4-chlorophenyl)-4-methylhex-5-ynyl]-1-fluorobenzene |
| SMILES | C#CC(C)(CCCc1ccc(F)c(Oc2ccc(Br)cc2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21BrClFO/c1-3-25(2,19-7-11-21(27)12-8-19)16-4-5-18-6-15-23(28)24(17-18)29-22-13-9-20(26)10-14-22/h1,6-15,17H,4-5,16H2,2H3 |
| InChIKey | SEGAHPWRWAZNRJ-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|