C28H29ClFNO — CID 70413109
N-(4-chlorophenyl)-2-fluoro-5-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-enyl]aniline (PubChem CID 70413109) has the molecular formula C28H29ClFNO and a molecular weight of 450.00 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-fluoro-5-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-enyl]aniline.
| Compound Name | N-(4-chlorophenyl)-2-fluoro-5-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-enyl]aniline |
|---|---|
| PubChem CID | 70413109 |
| Molecular Formula | C28H29ClFNO |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.19 |
| IUPAC Name | N-(4-chlorophenyl)-2-fluoro-5-[4-methyl-4-(4-prop-2-enoxyphenyl)hex-5-enyl]aniline |
| SMILES | C=CCOc1ccc(C(C)(C=C)CCCc2ccc(F)c(Nc3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C28H29ClFNO/c1-4-19-32-25-15-9-22(10-16-25)28(3,5-2)18-6-7-21-8-17-26(30)27(20-21)31-24-13-11-23(29)12-14-24/h4-5,8-17,20,31H,1-2,6-7,18-19H2,3H3 |
| InChIKey | RRHKKDRVMLHDRW-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|