C24H28OS — CID 21269738
4-methyl-2-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]thiophene (PubChem CID 21269738) has the molecular formula C24H28OS and a molecular weight of 364.55 g/mol. Its IUPAC name is 4-methyl-2-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]thiophene.
| Compound Name | 4-methyl-2-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]thiophene |
|---|---|
| PubChem CID | 21269738 |
| Molecular Formula | C24H28OS |
| Molecular Weight | 364.55 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-methyl-2-[3-methyl-6-(3-phenoxyphenyl)hexan-3-yl]thiophene |
| SMILES | CCC(C)(CCCc1cccc(Oc2ccccc2)c1)c1cc(C)cs1 |
| InChI | InChI=1S/C24H28OS/c1-4-24(3,23-16-19(2)18-26-23)15-9-11-20-10-8-14-22(17-20)25-21-12-6-5-7-13-21/h5-8,10,12-14,16-18H,4,9,11,15H2,1-3H3 |
| InChIKey | LWSLVSZSWYDFRW-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.55 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |