C24H28O2S — CID 70456571
4-ethyl-2-[2-methyl-1-[(3-phenoxyphenyl)methoxy]butan-2-yl]thiophene (PubChem CID 70456571) has the molecular formula C24H28O2S and a molecular weight of 380.55 g/mol. Its IUPAC name is 4-ethyl-2-[2-methyl-1-[(3-phenoxyphenyl)methoxy]butan-2-yl]thiophene.
| Compound Name | 4-ethyl-2-[2-methyl-1-[(3-phenoxyphenyl)methoxy]butan-2-yl]thiophene |
|---|---|
| PubChem CID | 70456571 |
| Molecular Formula | C24H28O2S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-ethyl-2-[2-methyl-1-[(3-phenoxyphenyl)methoxy]butan-2-yl]thiophene |
| SMILES | CCc1csc(C(C)(CC)COCc2cccc(Oc3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H28O2S/c1-4-19-15-23(27-17-19)24(3,5-2)18-25-16-20-10-9-13-22(14-20)26-21-11-7-6-8-12-21/h6-15,17H,4-5,16,18H2,1-3H3 |
| InChIKey | APFVWHLLIIEPHJ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |