C25H21BrN2O4S — CID 20521180
4-[2-[4-(3-bromo-2-methylphenoxy)phenyl]sulfonylphenoxy]benzene-1,2-diamine (PubChem CID 20521180) has the molecular formula C25H21BrN2O4S and a molecular weight of 525.42 g/mol. Its IUPAC name is 4-[2-[4-(3-bromo-2-methylphenoxy)phenyl]sulfonylphenoxy]benzene-1,2-diamine.
| Compound Name | 4-[2-[4-(3-bromo-2-methylphenoxy)phenyl]sulfonylphenoxy]benzene-1,2-diamine |
|---|---|
| PubChem CID | 20521180 |
| Molecular Formula | C25H21BrN2O4S |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 4-[2-[4-(3-bromo-2-methylphenoxy)phenyl]sulfonylphenoxy]benzene-1,2-diamine |
| SMILES | Cc1c(Br)cccc1Oc1ccc(S(=O)(=O)c2ccccc2Oc2ccc(N)c(N)c2)cc1 |
| InChI | InChI=1S/C25H21BrN2O4S/c1-16-20(26)5-4-7-23(16)31-17-9-12-19(13-10-17)33(29,30)25-8-3-2-6-24(25)32-18-11-14-21(27)22(28)15-18/h2-15H,27-28H2,1H3 |
| InChIKey | SSADUMQRNSUJGS-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|