C10H11F2NO2 — CID 95441850
methyl 3-(3,4-difluorophenoxy)propanimidate (PubChem CID 95441850) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is methyl 3-(3,4-difluorophenoxy)propanimidate.
| Compound Name | methyl 3-(3,4-difluorophenoxy)propanimidate |
|---|---|
| PubChem CID | 95441850 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | methyl 3-(3,4-difluorophenoxy)propanimidate |
| SMILES | [H]/N=C(/CCOc1ccc(F)c(F)c1)OC |
| InChI | InChI=1S/C10H11F2NO2/c1-14-10(13)4-5-15-7-2-3-8(11)9(12)6-7/h2-3,6,13H,4-5H2,1H3/b13-10- |
| InChIKey | QSILAEIGVYWVIA-RAXLEYEMSA-N |
| XLogP | 2.36 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|