C11H16F2IN3O — CID 111107606
1-[2-(3,4-difluorophenoxy)ethyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 111107606) has the molecular formula C11H16F2IN3O and a molecular weight of 371.17 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111107606 |
| Molecular Formula | C11H16F2IN3O |
| Molecular Weight | 371.17 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCCOc1ccc(F)c(F)c1.I |
| InChI | InChI=1S/C11H15F2N3O.HI/c1-14-11(15-2)16-5-6-17-8-3-4-9(12)10(13)7-8;/h3-4,7H,5-6H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | AXAHAKGNNRJFJH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|