C17H16F5N3O — CID 110930216
1-[[4-(3,4-difluorophenoxy)-2-(trifluoromethyl)phenyl]methyl]-2,3-dimethylguanidine (PubChem CID 110930216) has the molecular formula C17H16F5N3O and a molecular weight of 373.33 g/mol. Its IUPAC name is 1-[[4-(3,4-difluorophenoxy)-2-(trifluoromethyl)phenyl]methyl]-2,3-dimethylguanidine.
| Compound Name | 1-[[4-(3,4-difluorophenoxy)-2-(trifluoromethyl)phenyl]methyl]-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 110930216 |
| Molecular Formula | C17H16F5N3O |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[[4-(3,4-difluorophenoxy)-2-(trifluoromethyl)phenyl]methyl]-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)NCc1ccc(Oc2ccc(F)c(F)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H16F5N3O/c1-23-16(24-2)25-9-10-3-4-11(7-13(10)17(20,21)22)26-12-5-6-14(18)15(19)8-12/h3-8H,9H2,1-2H3,(H2,23,24,25) |
| InChIKey | DQONEFMDWCDRFJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|