C16H24F3N3OS — CID 111629074
1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine (PubChem CID 111629074) has the molecular formula C16H24F3N3OS and a molecular weight of 363.45 g/mol. Its IUPAC name is 1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 111629074 |
| Molecular Formula | C16H24F3N3OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[[4-methoxy-2-(trifluoromethyl)phenyl]methyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine |
| SMILES | C/N=C(\NCCCCSC)NCc1ccc(OC)cc1C(F)(F)F |
| InChI | InChI=1S/C16H24F3N3OS/c1-20-15(21-8-4-5-9-24-3)22-11-12-6-7-13(23-2)10-14(12)16(17,18)19/h6-7,10H,4-5,8-9,11H2,1-3H3,(H2,20,21,22) |
| InChIKey | OHWJWOKWLDMLPR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|