C20H32F3IN4O2 — CID 111694781
3-[[N'-methyl-N-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide (PubChem CID 111694781) has the molecular formula C20H32F3IN4O2 and a molecular weight of 544.40 g/mol. Its IUPAC name is 3-[[N'-methyl-N-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-methyl-N-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111694781 |
| Molecular Formula | C20H32F3IN4O2 |
| Molecular Weight | 544.40 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 3-[[N'-methyl-N-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CCN/C(=N\C)NCc1ccc(OC(C)(C)C)cc1C(F)(F)F.I |
| InChI | InChI=1S/C20H31F3N4O2.HI/c1-6-10-25-17(28)9-11-26-18(24-5)27-13-14-7-8-15(29-19(2,3)4)12-16(14)20(21,22)23;/h7-8,12H,6,9-11,13H2,1-5H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | GLWGKUPREVYJOK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|