C18H26F3N3O3S — CID 111499219
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111499219) has the molecular formula C18H26F3N3O3S and a molecular weight of 421.49 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111499219 |
| Molecular Formula | C18H26F3N3O3S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(OC(C)(C)C)cc1C(F)(F)F)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26F3N3O3S/c1-17(2,3)27-14-6-5-12(15(9-14)18(19,20)21)10-23-16(22-4)24-13-7-8-28(25,26)11-13/h5-6,9,13H,7-8,10-11H2,1-4H3,(H2,22,23,24) |
| InChIKey | WFJVAULNPRJGEM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|