C21H32F3IN4O2 — CID 111694685
2-methyl-1-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111694685) has the molecular formula C21H32F3IN4O2 and a molecular weight of 556.41 g/mol. Its IUPAC name is 2-methyl-1-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111694685 |
| Molecular Formula | C21H32F3IN4O2 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | 2-methyl-1-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N1CCCCC1)NCc1ccc(OC(C)(C)C)cc1C(F)(F)F.I |
| InChI | InChI=1S/C21H31F3N4O2.HI/c1-20(2,3)30-16-9-8-15(17(12-16)21(22,23)24)13-26-19(25-4)27-14-18(29)28-10-6-5-7-11-28;/h8-9,12H,5-7,10-11,13-14H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | DDCYKTMOCVPSDF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|