C22H33F3IN5O — CID 111694687
2-methyl-1-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111694687) has the molecular formula C22H33F3IN5O and a molecular weight of 567.44 g/mol. Its IUPAC name is 2-methyl-1-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111694687 |
| Molecular Formula | C22H33F3IN5O |
| Molecular Weight | 567.44 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 2-methyl-1-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]-3-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1c(C)nn(C)c1C)NCc1ccc(OC(C)(C)C)cc1C(F)(F)F.I |
| InChI | InChI=1S/C22H32F3N5O.HI/c1-14-18(15(2)30(7)29-14)10-11-27-20(26-6)28-13-16-8-9-17(31-21(3,4)5)12-19(16)22(23,24)25;/h8-9,12H,10-11,13H2,1-7H3,(H2,26,27,28);1H |
| InChIKey | NEIBFJWGWZEHLX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.44 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|