C19H29F3IN5O2S — CID 111772301
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111772301) has the molecular formula C19H29F3IN5O2S and a molecular weight of 575.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111772301 |
| Molecular Formula | C19H29F3IN5O2S |
| Molecular Weight | 575.44 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[[2-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cc(C(F)(F)F)ccc1N1CCN(C)CC1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C19H28F3N5O2S.HI/c1-23-18(25-16-5-10-30(28,29)13-16)24-12-14-11-15(19(20,21)22)3-4-17(14)27-8-6-26(2)7-9-27;/h3-4,11,16H,5-10,12-13H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | CUBGSCYFZQESLZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|