C10H17IN4O — CID 75494136
1,2-dimethyl-3-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide (PubChem CID 75494136) has the molecular formula C10H17IN4O and a molecular weight of 336.18 g/mol. Its IUPAC name is 1,2-dimethyl-3-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 75494136 |
| Molecular Formula | C10H17IN4O |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1,2-dimethyl-3-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCCOc1cccnc1.I |
| InChI | InChI=1S/C10H16N4O.HI/c1-11-10(12-2)14-6-7-15-9-4-3-5-13-8-9;/h3-5,8H,6-7H2,1-2H3,(H2,11,12,14);1H |
| InChIKey | QMZMQZSHVUQRHZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|