C13H22IN3O — CID 110917591
1-[2-(3,5-dimethylphenoxy)ethyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 110917591) has the molecular formula C13H22IN3O and a molecular weight of 363.24 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylphenoxy)ethyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110917591 |
| Molecular Formula | C13H22IN3O |
| Molecular Weight | 363.24 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-[2-(3,5-dimethylphenoxy)ethyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCCOc1cc(C)cc(C)c1.I |
| InChI | InChI=1S/C13H21N3O.HI/c1-10-7-11(2)9-12(8-10)17-6-5-16-13(14-3)15-4;/h7-9H,5-6H2,1-4H3,(H2,14,15,16);1H |
| InChIKey | LRYMKQHYYSEYPJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|