C16H22F2N4O2 — CID 119156287
1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine (PubChem CID 119156287) has the molecular formula C16H22F2N4O2 and a molecular weight of 340.37 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine |
|---|---|
| PubChem CID | 119156287 |
| Molecular Formula | C16H22F2N4O2 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-(1-methyl-6-oxopiperidin-3-yl)guanidine |
| SMILES | C/N=C(\NCCOc1ccc(F)c(F)c1)NC1CCC(=O)N(C)C1 |
| InChI | InChI=1S/C16H22F2N4O2/c1-19-16(21-11-3-6-15(23)22(2)10-11)20-7-8-24-12-4-5-13(17)14(18)9-12/h4-5,9,11H,3,6-8,10H2,1-2H3,(H2,19,20,21) |
| InChIKey | NWMWWZZAIJZKAD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|