C18H26F2N4O2 — CID 111835157
1-[2-(3,4-difluorophenoxy)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine (PubChem CID 111835157) has the molecular formula C18H26F2N4O2 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111835157 |
| Molecular Formula | C18H26F2N4O2 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-ethyl-2-[3-(2-oxopyrrolidin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCCC1=O)NCCOc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H26F2N4O2/c1-2-21-18(22-8-4-11-24-10-3-5-17(24)25)23-9-12-26-14-6-7-15(19)16(20)13-14/h6-7,13H,2-5,8-12H2,1H3,(H2,21,22,23) |
| InChIKey | YQNSVVXXKUAKSX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|