C14H21F2N3O2 — CID 111836767
1-[2-(3,4-difluorophenoxy)ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine (PubChem CID 111836767) has the molecular formula C14H21F2N3O2 and a molecular weight of 301.34 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 111836767 |
| Molecular Formula | C14H21F2N3O2 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-3-(1-methoxypropan-2-yl)-2-methylguanidine |
| SMILES | C/N=C(/NCCOc1ccc(F)c(F)c1)NC(C)COC |
| InChI | InChI=1S/C14H21F2N3O2/c1-10(9-20-3)19-14(17-2)18-6-7-21-11-4-5-12(15)13(16)8-11/h4-5,8,10H,6-7,9H2,1-3H3,(H2,17,18,19) |
| InChIKey | UOHAZEOLTQZMRU-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|