C18H22F2IN3O — CID 111834918
1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide (PubChem CID 111834918) has the molecular formula C18H22F2IN3O and a molecular weight of 461.29 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111834918 |
| Molecular Formula | C18H22F2IN3O |
| Molecular Weight | 461.29 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-[2-(3,4-difluorophenoxy)ethyl]-2-methyl-3-(2-phenylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc(F)c(F)c1)NCCc1ccccc1.I |
| InChI | InChI=1S/C18H21F2N3O.HI/c1-21-18(22-10-9-14-5-3-2-4-6-14)23-11-12-24-15-7-8-16(19)17(20)13-15;/h2-8,13H,9-12H2,1H3,(H2,21,22,23);1H |
| InChIKey | CWNZOTSSUKPFNQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|