C11H10F2O3S — CID 82369151
1,2-difluoro-4-(2-prop-2-ynylsulfonylethoxy)benzene (PubChem CID 82369151) has the molecular formula C11H10F2O3S and a molecular weight of 260.26 g/mol. Its IUPAC name is 1,2-difluoro-4-(2-prop-2-ynylsulfonylethoxy)benzene.
| Compound Name | 1,2-difluoro-4-(2-prop-2-ynylsulfonylethoxy)benzene |
|---|---|
| PubChem CID | 82369151 |
| Molecular Formula | C11H10F2O3S |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 1,2-difluoro-4-(2-prop-2-ynylsulfonylethoxy)benzene |
| SMILES | C#CCS(=O)(=O)CCOc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H10F2O3S/c1-2-6-17(14,15)7-5-16-9-3-4-10(12)11(13)8-9/h1,3-4,8H,5-7H2 |
| InChIKey | JRZCRMINJWQWBE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|