C16H17F2NO3S — CID 90518736
N-(3,4-difluorophenyl)-2-(4-ethylphenoxy)ethanesulfonamide (PubChem CID 90518736) has the molecular formula C16H17F2NO3S and a molecular weight of 341.38 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-(4-ethylphenoxy)ethanesulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-2-(4-ethylphenoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 90518736 |
| Molecular Formula | C16H17F2NO3S |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-(4-ethylphenoxy)ethanesulfonamide |
| SMILES | CCc1ccc(OCCS(=O)(=O)Nc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H17F2NO3S/c1-2-12-3-6-14(7-4-12)22-9-10-23(20,21)19-13-5-8-15(17)16(18)11-13/h3-8,11,19H,2,9-10H2,1H3 |
| InChIKey | SCNABIBRLRNCRT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |