C14H15FN2O4S — CID 110301907
2-(4-fluorophenoxy)-N-(6-methoxy-3-pyridinyl)ethanesulfonamide (PubChem CID 110301907) has the molecular formula C14H15FN2O4S and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(6-methoxy-3-pyridinyl)ethanesulfonamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(6-methoxy-3-pyridinyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110301907 |
| Molecular Formula | C14H15FN2O4S |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(6-methoxy-3-pyridinyl)ethanesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)CCOc2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C14H15FN2O4S/c1-20-14-7-4-12(10-16-14)17-22(18,19)9-8-21-13-5-2-11(15)3-6-13/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | IHSCJEYSTCCVKV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |