C15H14FN5O3S — CID 90518653
2-(4-fluorophenoxy)-N-[4-(tetrazol-1-yl)phenyl]ethanesulfonamide (PubChem CID 90518653) has the molecular formula C15H14FN5O3S and a molecular weight of 363.37 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-[4-(tetrazol-1-yl)phenyl]ethanesulfonamide.
| Compound Name | 2-(4-fluorophenoxy)-N-[4-(tetrazol-1-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 90518653 |
| Molecular Formula | C15H14FN5O3S |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-[4-(tetrazol-1-yl)phenyl]ethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccc(F)cc1)Nc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C15H14FN5O3S/c16-12-1-7-15(8-2-12)24-9-10-25(22,23)18-13-3-5-14(6-4-13)21-11-17-19-20-21/h1-8,11,18H,9-10H2 |
| InChIKey | OLAIUBQWLBNUGS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |