C22H23NO3S — CID 90518830
2-(4-ethylphenoxy)-N-(2-phenylphenyl)ethanesulfonamide (PubChem CID 90518830) has the molecular formula C22H23NO3S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-(2-phenylphenyl)ethanesulfonamide.
| Compound Name | 2-(4-ethylphenoxy)-N-(2-phenylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 90518830 |
| Molecular Formula | C22H23NO3S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-(2-phenylphenyl)ethanesulfonamide |
| SMILES | CCc1ccc(OCCS(=O)(=O)Nc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO3S/c1-2-18-12-14-20(15-13-18)26-16-17-27(24,25)23-22-11-7-6-10-21(22)19-8-4-3-5-9-19/h3-15,23H,2,16-17H2,1H3 |
| InChIKey | BKVCMXROCUHICS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |