C16H16F3NO3S — CID 90518914
2-(4-ethylphenoxy)-N-(2,3,4-trifluorophenyl)ethanesulfonamide (PubChem CID 90518914) has the molecular formula C16H16F3NO3S and a molecular weight of 359.37 g/mol. Its IUPAC name is 2-(4-ethylphenoxy)-N-(2,3,4-trifluorophenyl)ethanesulfonamide.
| Compound Name | 2-(4-ethylphenoxy)-N-(2,3,4-trifluorophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 90518914 |
| Molecular Formula | C16H16F3NO3S |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-(4-ethylphenoxy)-N-(2,3,4-trifluorophenyl)ethanesulfonamide |
| SMILES | CCc1ccc(OCCS(=O)(=O)Nc2ccc(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C16H16F3NO3S/c1-2-11-3-5-12(6-4-11)23-9-10-24(21,22)20-14-8-7-13(17)15(18)16(14)19/h3-8,20H,2,9-10H2,1H3 |
| InChIKey | QXVMNEKPOIOXHG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|