C14H13F2NO3S — CID 113102513
N-[2-(3,4-difluorophenoxy)ethyl]benzenesulfonamide (PubChem CID 113102513) has the molecular formula C14H13F2NO3S and a molecular weight of 313.33 g/mol. Its IUPAC name is N-[2-(3,4-difluorophenoxy)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(3,4-difluorophenoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113102513 |
| Molecular Formula | C14H13F2NO3S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[2-(3,4-difluorophenoxy)ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C14H13F2NO3S/c15-13-7-6-11(10-14(13)16)20-9-8-17-21(18,19)12-4-2-1-3-5-12/h1-7,10,17H,8-9H2 |
| InChIKey | JAYDVEVWQPBTMP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|