C60H46F16N4O4 — CID 136745176
5,10,15,20-tetrakis(4-butoxy-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin (PubChem CID 136745176) has the molecular formula C60H46F16N4O4 and a molecular weight of 1191.02 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-butoxy-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-butoxy-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136745176 |
| Molecular Formula | C60H46F16N4O4 |
| Molecular Weight | 1191.02 g/mol |
| Exact Mass | 1190.33 |
| IUPAC Name | 5,10,15,20-tetrakis(4-butoxy-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin |
| SMILES | CCCCOc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(OCCCC)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(OCCCC)c(F)c4F)c4nc(c(-c5c(F)c(F)c(OCCCC)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C60H46F16N4O4/c1-5-9-21-81-57-49(69)41(61)37(42(62)50(57)70)33-25-13-15-27(77-25)34(38-43(63)51(71)58(52(72)44(38)64)82-22-10-6-2)29-17-19-31(79-29)36(40-47(67)55(75)60(56(76)48(40)68)84-24-12-8-4)32-20-18-30(80-32)35(28-16-14-26(33)78-28)39-45(65)53(73)59(54(74)46(39)66)83-23-11-7-3/h13-20,77,80H,5-12,21-24H2,1-4H3/b33-25+,33-26+,34-27+,34-29+,35-28+,35-30+,36-31+,36-32+ |
| InChIKey | PBAPCOVUXLKHBB-KRQUYQEWSA-N |
| XLogP | 18.26 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1191.02 |
| LogP ≤ 5 | 18.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|