C52H30F16N4O4 — CID 136745174
5,10,15,20-tetrakis(4-ethoxy-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin (PubChem CID 136745174) has the molecular formula C52H30F16N4O4 and a molecular weight of 1078.80 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-ethoxy-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-ethoxy-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136745174 |
| Molecular Formula | C52H30F16N4O4 |
| Molecular Weight | 1078.80 g/mol |
| Exact Mass | 1078.20 |
| IUPAC Name | 5,10,15,20-tetrakis(4-ethoxy-2,3,5,6-tetrafluorophenyl)-21,23-dihydroporphyrin |
| SMILES | CCOc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(OCC)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(OCC)c(F)c4F)c4nc(c(-c5c(F)c(F)c(OCC)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C52H30F16N4O4/c1-5-73-49-41(61)33(53)29(34(54)42(49)62)25-17-9-11-19(69-17)26(30-35(55)43(63)50(74-6-2)44(64)36(30)56)21-13-15-23(71-21)28(32-39(59)47(67)52(76-8-4)48(68)40(32)60)24-16-14-22(72-24)27(20-12-10-18(25)70-20)31-37(57)45(65)51(75-7-3)46(66)38(31)58/h9-16,69,72H,5-8H2,1-4H3/b25-17+,25-18+,26-19+,26-21+,27-20+,27-22+,28-23+,28-24+ |
| InChIKey | FFKUSXJBSXFRJO-WBYGILQTSA-N |
| XLogP | 15.14 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1078.80 |
| LogP ≤ 5 | 15.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|