C55H50F12N4S3 — CID 136716748
5,10,15-tris(2,3,5,6-tetrafluoro-4-hexylsulfanylphenyl)-22,23-dihydro-21H-corrin (PubChem CID 136716748) has the molecular formula C55H50F12N4S3 and a molecular weight of 1091.21 g/mol. Its IUPAC name is 5,10,15-tris(2,3,5,6-tetrafluoro-4-hexylsulfanylphenyl)-22,23-dihydro-21H-corrin.
| Compound Name | 5,10,15-tris(2,3,5,6-tetrafluoro-4-hexylsulfanylphenyl)-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 136716748 |
| Molecular Formula | C55H50F12N4S3 |
| Molecular Weight | 1091.21 g/mol |
| Exact Mass | 1090.30 |
| IUPAC Name | 5,10,15-tris(2,3,5,6-tetrafluoro-4-hexylsulfanylphenyl)-22,23-dihydro-21H-corrin |
| SMILES | CCCCCCSc1c(F)c(F)c(-c2c3nc(c4ccc([nH]4)c(-c4c(F)c(F)c(SCCCCCC)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(SCCCCCC)c(F)c4F)c4ccc2[nH]4)C=C3)c(F)c1F |
| InChI | InChI=1S/C55H50F12N4S3/c1-4-7-10-13-24-72-53-47(62)41(56)38(42(57)48(53)63)35-29-18-16-27(68-29)28-17-19-30(69-28)36(39-43(58)49(64)54(50(65)44(39)59)73-25-14-11-8-5-2)32-21-23-34(71-32)37(33-22-20-31(35)70-33)40-45(60)51(66)55(52(67)46(40)61)74-26-15-12-9-6-3/h16-23,68,70-71H,4-15,24-26H2,1-3H3/b28-27-,35-29+,35-31+,36-30+,36-32+,37-33+,37-34+ |
| InChIKey | GMMUGSPABWOESD-GEVXINQYSA-N |
| XLogP | 19.38 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.21 |
| LogP ≤ 5 | 19.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|