C49H36F4N4O4S — CID 11136639
2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(4-methoxyphenyl)-23,24-dihydroporphyrin-5-yl]phenyl]sulfanylethanol (PubChem CID 11136639) has the molecular formula C49H36F4N4O4S and a molecular weight of 852.91 g/mol. Its IUPAC name is 2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(4-methoxyphenyl)-23,24-dihydroporphyrin-5-yl]phenyl]sulfanylethanol.
| Compound Name | 2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(4-methoxyphenyl)-23,24-dihydroporphyrin-5-yl]phenyl]sulfanylethanol |
|---|---|
| PubChem CID | 11136639 |
| Molecular Formula | C49H36F4N4O4S |
| Molecular Weight | 852.91 g/mol |
| Exact Mass | 852.24 |
| IUPAC Name | 2-[2,3,5,6-tetrafluoro-4-[10,15,20-tris(4-methoxyphenyl)-23,24-dihydroporphyrin-5-yl]phenyl]sulfanylethanol |
| SMILES | COc1ccc(-c2c3nc(c(-c4c(F)c(F)c(SCCO)c(F)c4F)c4nc(c(-c5ccc(OC)cc5)c5ccc([nH]5)c(-c5ccc(OC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C49H36F4N4O4S/c1-59-29-10-4-26(5-11-29)40-32-16-18-34(54-32)41(27-6-12-30(60-2)13-7-27)36-20-22-38(56-36)43(44-45(50)47(52)49(62-25-24-58)48(53)46(44)51)39-23-21-37(57-39)42(35-19-17-33(40)55-35)28-8-14-31(61-3)15-9-28/h4-23,54-55,58H,24-25H2,1-3H3/b40-32-,40-33-,41-34-,41-36-,42-35-,42-37-,43-38+,43-39+ |
| InChIKey | IWAFCBRPAYUFKP-RYCYNUCPSA-N |
| XLogP | 11.99 |
| TPSA | 105.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.91 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|